About 6-(azepan-1-yl)-6-oxohexanamide;dodecane
6-(azepan-1-yl)-6-oxohexanamide;dodecane (PubChem CID 174982677) has the molecular formula C24H48N2O2
and a molecular weight of 396.66 g/mol. Its IUPAC name is 6-(azepan-1-yl)-6-oxohexanamide;dodecane.
Molecular Properties
| Compound Name | 6-(azepan-1-yl)-6-oxohexanamide;dodecane |
| PubChem CID | 174982677 |
| Molecular Formula | C24H48N2O2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.37 |
| IUPAC Name | 6-(azepan-1-yl)-6-oxohexanamide;dodecane |
| SMILES | CCCCCCCCCCCC.NC(=O)CCCCC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C12H22N2O2.C12H26/c13-11(15)7-3-4-8-12(16)14-9-5-1-2-6-10-14;1-3-5-7-9-11-12-10-8-6-4-2/h1-10H2,(H2,13,15);3-12H2,1-2H3 |
| InChIKey | LOQQOXPUXOHOSE-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(azepan-1-yl)-6-oxohexanamide;dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(azepan-1-yl)-6-oxohexanamide;dodecane?
The IUPAC name of 6-(azepan-1-yl)-6-oxohexanamide;dodecane (CID 174982677) is 6-(azepan-1-yl)-6-oxohexanamide;dodecane.
What is the SMILES notation for 6-(azepan-1-yl)-6-oxohexanamide;dodecane?
The canonical SMILES for 6-(azepan-1-yl)-6-oxohexanamide;dodecane is CCCCCCCCCCCC.NC(=O)CCCCC(=O)N1CCCCCC1.
What is the InChIKey of 6-(azepan-1-yl)-6-oxohexanamide;dodecane?
The InChIKey is LOQQOXPUXOHOSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2.C12H26/c13-11(15)7-3-4-8-12(16)14-9-5-1-2-6-10-14;1-3-5-7-9-11-12-10-8-6-4-2/h1-10H2,(H2,13,15);3-12H2,1-2H3.
What are the key properties of 6-(azepan-1-yl)-6-oxohexanamide;dodecane?
6-(azepan-1-yl)-6-oxohexanamide;dodecane has a molecular weight of 396.66 g/mol, XLogP of 6.36, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(azepan-1-yl)-6-oxohexanamide;dodecane is sourced from PubChem (CID 174982677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).