C22H39NO — CID 91705036
(8Z,12Z)-1-pyrrolidin-1-yloctadeca-8,12-dien-1-one (PubChem CID 91705036) has the molecular formula C22H39NO and a molecular weight of 333.56 g/mol. Its IUPAC name is (8Z,12Z)-1-pyrrolidin-1-yloctadeca-8,12-dien-1-one.
| Compound Name | (8Z,12Z)-1-pyrrolidin-1-yloctadeca-8,12-dien-1-one |
|---|---|
| PubChem CID | 91705036 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | (8Z,12Z)-1-pyrrolidin-1-yloctadeca-8,12-dien-1-one |
| SMILES | CCCCC/C=C\CC/C=C\CCCCCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C22H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22(24)23-20-17-18-21-23/h6-7,10-11H,2-5,8-9,12-21H2,1H3/b7-6-,11-10- |
| InChIKey | RFLZBYLROMFPSB-QOXWLJPHSA-N |
| XLogP | 6.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|