C26H45NO — CID 91705178
(7Z,13Z,16Z)-1-pyrrolidin-1-yldocosa-7,13,16-trien-1-one (PubChem CID 91705178) has the molecular formula C26H45NO and a molecular weight of 387.65 g/mol. Its IUPAC name is (7Z,13Z,16Z)-1-pyrrolidin-1-yldocosa-7,13,16-trien-1-one.
| Compound Name | (7Z,13Z,16Z)-1-pyrrolidin-1-yldocosa-7,13,16-trien-1-one |
|---|---|
| PubChem CID | 91705178 |
| Molecular Formula | C26H45NO |
| Molecular Weight | 387.65 g/mol |
| Exact Mass | 387.35 |
| IUPAC Name | (7Z,13Z,16Z)-1-pyrrolidin-1-yldocosa-7,13,16-trien-1-one |
| SMILES | CCCCC/C=C\C/C=C\CCCC/C=C\CCCCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C26H45NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-26(28)27-24-21-22-25-27/h6-7,9-10,15-16H,2-5,8,11-14,17-25H2,1H3/b7-6-,10-9-,16-15- |
| InChIKey | YUTMTCKMYBNJRA-URZBRJKDSA-N |
| XLogP | 7.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.65 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|