C30H53NO — CID 91705242
(5Z,9Z,17Z)-1-pyrrolidin-1-ylhexacosa-5,9,17-trien-1-one (PubChem CID 91705242) has the molecular formula C30H53NO and a molecular weight of 443.76 g/mol. Its IUPAC name is (5Z,9Z,17Z)-1-pyrrolidin-1-ylhexacosa-5,9,17-trien-1-one.
| Compound Name | (5Z,9Z,17Z)-1-pyrrolidin-1-ylhexacosa-5,9,17-trien-1-one |
|---|---|
| PubChem CID | 91705242 |
| Molecular Formula | C30H53NO |
| Molecular Weight | 443.76 g/mol |
| Exact Mass | 443.41 |
| IUPAC Name | (5Z,9Z,17Z)-1-pyrrolidin-1-ylhexacosa-5,9,17-trien-1-one |
| SMILES | CCCCCCCC/C=C\CCCCCC/C=C\CC/C=C\CCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C30H53NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-27-30(32)31-28-25-26-29-31/h9-10,17-18,21-22H,2-8,11-16,19-20,23-29H2,1H3/b10-9-,18-17-,22-21- |
| InChIKey | FPRQCWHSDMKZIK-DSVTWUIQSA-N |
| XLogP | 9.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.76 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|