C24H47N2O+ — CID 5475226
(E)-1-(4,4-dimethylpiperazin-4-ium-1-yl)octadec-9-en-1-one (PubChem CID 5475226) has the molecular formula C24H47N2O+ and a molecular weight of 379.65 g/mol. Its IUPAC name is (E)-1-(4,4-dimethylpiperazin-4-ium-1-yl)octadec-9-en-1-one.
| Compound Name | (E)-1-(4,4-dimethylpiperazin-4-ium-1-yl)octadec-9-en-1-one |
|---|---|
| PubChem CID | 5475226 |
| Molecular Formula | C24H47N2O+ |
| Molecular Weight | 379.65 g/mol |
| Exact Mass | 379.37 |
| IUPAC Name | (E)-1-(4,4-dimethylpiperazin-4-ium-1-yl)octadec-9-en-1-one |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)N1CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C24H47N2O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(27)25-20-22-26(2,3)23-21-25/h11-12H,4-10,13-23H2,1-3H3/q+1/b12-11+ |
| InChIKey | MRMFXYUQQIAQJY-VAWYXSNFSA-N |
| XLogP | 5.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.65 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|