C25H51N2O5S+ — CID 5475225
(E)-1-(4,4-dimethylpiperazin-4-ium-1-yl)octadec-9-en-1-one;methyl hydrogen sulfate (PubChem CID 5475225) has the molecular formula C25H51N2O5S+ and a molecular weight of 491.76 g/mol. Its IUPAC name is (E)-1-(4,4-dimethylpiperazin-4-ium-1-yl)octadec-9-en-1-one;methyl hydrogen sulfate.
| Compound Name | (E)-1-(4,4-dimethylpiperazin-4-ium-1-yl)octadec-9-en-1-one;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 5475225 |
| Molecular Formula | C25H51N2O5S+ |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 491.35 |
| IUPAC Name | (E)-1-(4,4-dimethylpiperazin-4-ium-1-yl)octadec-9-en-1-one;methyl hydrogen sulfate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)N1CC[N+](C)(C)CC1.COS(=O)(=O)O |
| InChI | InChI=1S/C24H47N2O.CH4O4S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(27)25-20-22-26(2,3)23-21-25;1-5-6(2,3)4/h11-12H,4-10,13-23H2,1-3H3;1H3,(H,2,3,4)/q+1;/b12-11+; |
| InChIKey | MRXWKWHGERLVEO-CALJPSDSSA-N |
| XLogP | 5.38 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|