About methyl hydrogen sulfate;(E)-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]octadec-9-enamide
methyl hydrogen sulfate;(E)-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]octadec-9-enamide (PubChem CID 5475250) has the molecular formula C27H55N2O5S+
and a molecular weight of 519.81 g/mol. Its IUPAC name is methyl hydrogen sulfate;(E)-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]octadec-9-enamide.
Molecular Properties
| Compound Name | methyl hydrogen sulfate;(E)-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]octadec-9-enamide |
| PubChem CID | 5475250 |
| Molecular Formula | C27H55N2O5S+ |
| Molecular Weight | 519.81 g/mol |
| Exact Mass | 519.38 |
| IUPAC Name | methyl hydrogen sulfate;(E)-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)NCC[N+]1(C)CCCCC1.COS(=O)(=O)O |
| InChI | InChI=1S/C26H50N2O.CH4O4S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-21-26(29)27-22-25-28(2)23-19-17-20-24-28;1-5-6(2,3)4/h10-11H,3-9,12-25H2,1-2H3;1H3,(H,2,3,4)/p+1/b11-10+; |
| InChIKey | UFEHWYROJPLZFI-ASTDGNLGSA-O |
| XLogP | 6.21 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 519.81 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methyl hydrogen sulfate;(E)-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]octadec-9-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl hydrogen sulfate;(E)-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]octadec-9-enamide?
The IUPAC name of methyl hydrogen sulfate;(E)-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]octadec-9-enamide (CID 5475250) is methyl hydrogen sulfate;(E)-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]octadec-9-enamide.
What is the SMILES notation for methyl hydrogen sulfate;(E)-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]octadec-9-enamide?
The canonical SMILES for methyl hydrogen sulfate;(E)-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]octadec-9-enamide is CCCCCCCC/C=C/CCCCCCCC(=O)NCC[N+]1(C)CCCCC1.COS(=O)(=O)O.
What is the InChIKey of methyl hydrogen sulfate;(E)-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]octadec-9-enamide?
The InChIKey is UFEHWYROJPLZFI-ASTDGNLGSA-O. The full InChI is InChI=1S/C26H50N2O.CH4O4S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-21-26(29)27-22-25-28(2)23-19-17-20-24-28;1-5-6(2,3)4/h10-11H,3-9,12-25H2,1-2H3;1H3,(H,2,3,4)/p+1/b11-10+;.
What are the key properties of methyl hydrogen sulfate;(E)-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]octadec-9-enamide?
methyl hydrogen sulfate;(E)-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]octadec-9-enamide has a molecular weight of 519.81 g/mol, XLogP of 6.21, 19 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl hydrogen sulfate;(E)-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]octadec-9-enamide is sourced from PubChem (CID 5475250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).