C26H52N4O2+2 — CID 3145060
N,N'-bis[2-(1-methylazepan-1-ium-1-yl)ethyl]octanediamide (PubChem CID 3145060) has the molecular formula C26H52N4O2+2 and a molecular weight of 452.73 g/mol. Its IUPAC name is N,N'-bis[2-(1-methylazepan-1-ium-1-yl)ethyl]octanediamide.
| Compound Name | N,N'-bis[2-(1-methylazepan-1-ium-1-yl)ethyl]octanediamide |
|---|---|
| PubChem CID | 3145060 |
| Molecular Formula | C26H52N4O2+2 |
| Molecular Weight | 452.73 g/mol |
| Exact Mass | 452.41 |
| IUPAC Name | N,N'-bis[2-(1-methylazepan-1-ium-1-yl)ethyl]octanediamide |
| SMILES | C[N+]1(CCNC(=O)CCCCCCC(=O)NCC[N+]2(C)CCCCCC2)CCCCCC1 |
| InChI | InChI=1S/C26H50N4O2/c1-29(19-11-5-6-12-20-29)23-17-27-25(31)15-9-3-4-10-16-26(32)28-18-24-30(2)21-13-7-8-14-22-30/h3-24H2,1-2H3/p+2 |
| InChIKey | GVVTYYJPBWHCCK-UHFFFAOYSA-P |
| XLogP | 3.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.73 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|