C33H57N2O2+ — CID 162679174
N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-2-[2-[(Z)-octadec-9-enoxy]phenyl]acetamide (PubChem CID 162679174) has the molecular formula C33H57N2O2+ and a molecular weight of 513.83 g/mol. Its IUPAC name is N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-2-[2-[(Z)-octadec-9-enoxy]phenyl]acetamide.
| Compound Name | N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-2-[2-[(Z)-octadec-9-enoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 162679174 |
| Molecular Formula | C33H57N2O2+ |
| Molecular Weight | 513.83 g/mol |
| Exact Mass | 513.44 |
| IUPAC Name | N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]-2-[2-[(Z)-octadec-9-enoxy]phenyl]acetamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOc1ccccc1CC(=O)NCC[N+]1(C)CCCC1 |
| InChI | InChI=1S/C33H56N2O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-29-37-32-24-19-18-23-31(32)30-33(36)34-25-28-35(2)26-20-21-27-35/h10-11,18-19,23-24H,3-9,12-17,20-22,25-30H2,1-2H3/p+1/b11-10- |
| InChIKey | JURYWSHEASBHSL-KHPPLWFESA-O |
| XLogP | 8.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.83 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|