C20H40N4O2+2 — CID 3145061
N,N'-bis[2-(1-methylazepan-1-ium-1-yl)ethyl]oxamide (PubChem CID 3145061) has the molecular formula C20H40N4O2+2 and a molecular weight of 368.57 g/mol. Its IUPAC name is N,N'-bis[2-(1-methylazepan-1-ium-1-yl)ethyl]oxamide.
| Compound Name | N,N'-bis[2-(1-methylazepan-1-ium-1-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 3145061 |
| Molecular Formula | C20H40N4O2+2 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.31 |
| IUPAC Name | N,N'-bis[2-(1-methylazepan-1-ium-1-yl)ethyl]oxamide |
| SMILES | C[N+]1(CCNC(=O)C(=O)NCC[N+]2(C)CCCCCC2)CCCCCC1 |
| InChI | InChI=1S/C20H38N4O2/c1-23(13-7-3-4-8-14-23)17-11-21-19(25)20(26)22-12-18-24(2)15-9-5-6-10-16-24/h3-18H2,1-2H3/p+2 |
| InChIKey | XEGPBSROWCCWHC-UHFFFAOYSA-P |
| XLogP | 1.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|