C16H26I2N4O2 — CID 135959653
6-[(E)-hydroxyiminomethyl]-1-methyl-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]pyridin-1-ium-3-carboxamide diiodide (PubChem CID 135959653) has the molecular formula C16H26I2N4O2 and a molecular weight of 560.22 g/mol. Its IUPAC name is 6-[(E)-hydroxyiminomethyl]-1-methyl-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]pyridin-1-ium-3-carboxamide diiodide.
| Compound Name | 6-[(E)-hydroxyiminomethyl]-1-methyl-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]pyridin-1-ium-3-carboxamide diiodide |
|---|---|
| PubChem CID | 135959653 |
| Molecular Formula | C16H26I2N4O2 |
| Molecular Weight | 560.22 g/mol |
| Exact Mass | 560.01 |
| IUPAC Name | 6-[(E)-hydroxyiminomethyl]-1-methyl-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]pyridin-1-ium-3-carboxamide diiodide |
| SMILES | C[n+]1cc(C(=O)NCC[N+]2(C)CCCCC2)ccc1/C=N/O.[I-].[I-] |
| InChI | InChI=1S/C16H24N4O2.2HI/c1-19-13-14(6-7-15(19)12-18-22)16(21)17-8-11-20(2)9-4-3-5-10-20;;/h6-7,12-13H,3-5,8-11H2,1-2H3;2*1H |
| InChIKey | CQXKTSCUFOAJNC-UHFFFAOYSA-N |
| XLogP | -5.31 |
| TPSA | 65.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.22 |
| LogP ≤ 5 | -5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|