C16H26N4O2+2 — CID 135779759
6-[(Z)-hydroxyiminomethyl]-1-methyl-N-[3-(1-methylpyrrolidin-1-ium-1-yl)propyl]pyridin-1-ium-3-carboxamide (PubChem CID 135779759) has the molecular formula C16H26N4O2+2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 6-[(Z)-hydroxyiminomethyl]-1-methyl-N-[3-(1-methylpyrrolidin-1-ium-1-yl)propyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 6-[(Z)-hydroxyiminomethyl]-1-methyl-N-[3-(1-methylpyrrolidin-1-ium-1-yl)propyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 135779759 |
| Molecular Formula | C16H26N4O2+2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 6-[(Z)-hydroxyiminomethyl]-1-methyl-N-[3-(1-methylpyrrolidin-1-ium-1-yl)propyl]pyridin-1-ium-3-carboxamide |
| SMILES | C[n+]1cc(C(=O)NCCC[N+]2(C)CCCC2)ccc1/C=N\O |
| InChI | InChI=1S/C16H24N4O2/c1-19-13-14(6-7-15(19)12-18-22)16(21)17-8-5-11-20(2)9-3-4-10-20/h6-7,12-13H,3-5,8-11H2,1-2H3/p+2 |
| InChIKey | JRHNUDBWSPRJRV-UHFFFAOYSA-P |
| XLogP | 0.68 |
| TPSA | 65.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|