C19H20N5O3+ — CID 135840112
N-[2-[[6-[(Z)-hydroxyiminomethyl]-1-methylpyridin-1-ium-3-carbonyl]amino]ethyl]-1H-indole-2-carboxamide (PubChem CID 135840112) has the molecular formula C19H20N5O3+ and a molecular weight of 366.40 g/mol. Its IUPAC name is N-[2-[[6-[(Z)-hydroxyiminomethyl]-1-methylpyridin-1-ium-3-carbonyl]amino]ethyl]-1H-indole-2-carboxamide.
| Compound Name | N-[2-[[6-[(Z)-hydroxyiminomethyl]-1-methylpyridin-1-ium-3-carbonyl]amino]ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 135840112 |
| Molecular Formula | C19H20N5O3+ |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[2-[[6-[(Z)-hydroxyiminomethyl]-1-methylpyridin-1-ium-3-carbonyl]amino]ethyl]-1H-indole-2-carboxamide |
| SMILES | C[n+]1cc(C(=O)NCCNC(=O)c2cc3ccccc3[nH]2)ccc1/C=N\O |
| InChI | InChI=1S/C19H19N5O3/c1-24-12-14(6-7-15(24)11-22-27)18(25)20-8-9-21-19(26)17-10-13-4-2-3-5-16(13)23-17/h2-7,10-12H,8-9H2,1H3,(H3,20,21,23,25,26)/p+1 |
| InChIKey | PSFJRXBYAYAVQS-UHFFFAOYSA-O |
| XLogP | 0.96 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|