C19H16F3N3O2 — CID 34509270
N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]-1H-indole-2-carboxamide (PubChem CID 34509270) has the molecular formula C19H16F3N3O2 and a molecular weight of 375.35 g/mol. Its IUPAC name is N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]-1H-indole-2-carboxamide.
| Compound Name | N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 34509270 |
| Molecular Formula | C19H16F3N3O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cc2ccccc2[nH]1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F3N3O2/c20-19(21,22)14-7-5-12(6-8-14)17(26)23-9-10-24-18(27)16-11-13-3-1-2-4-15(13)25-16/h1-8,11,25H,9-10H2,(H,23,26)(H,24,27) |
| InChIKey | YCZFRBPMHYWSFU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|