C23H16F3N3O — CID 4281908
N-[[phenyl-[4-(trifluoromethyl)phenyl]methylidene]amino]-1H-indole-2-carboxamide (PubChem CID 4281908) has the molecular formula C23H16F3N3O and a molecular weight of 407.40 g/mol. Its IUPAC name is N-[[phenyl-[4-(trifluoromethyl)phenyl]methylidene]amino]-1H-indole-2-carboxamide.
| Compound Name | N-[[phenyl-[4-(trifluoromethyl)phenyl]methylidene]amino]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 4281908 |
| Molecular Formula | C23H16F3N3O |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-[[phenyl-[4-(trifluoromethyl)phenyl]methylidene]amino]-1H-indole-2-carboxamide |
| SMILES | O=C(NN=C(c1ccccc1)c1ccc(C(F)(F)F)cc1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H16F3N3O/c24-23(25,26)18-12-10-16(11-13-18)21(15-6-2-1-3-7-15)28-29-22(30)20-14-17-8-4-5-9-19(17)27-20/h1-14,27H,(H,29,30) |
| InChIKey | SECVABZUOSMHKV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|