About ethane;1H-indole-2-carboxylic acid
ethane;1H-indole-2-carboxylic acid (PubChem CID 91052830) has the molecular formula C15H25NO2
and a molecular weight of 251.37 g/mol. Its IUPAC name is ethane;1H-indole-2-carboxylic acid.
Molecular Properties
| Compound Name | ethane;1H-indole-2-carboxylic acid |
| PubChem CID | 91052830 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | ethane;1H-indole-2-carboxylic acid |
| SMILES | CC.CC.CC.O=C(O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C9H7NO2.3C2H6/c11-9(12)8-5-6-3-1-2-4-7(6)10-8;3*1-2/h1-5,10H,(H,11,12);3*1-2H3 |
| InChIKey | OFSIGLZVOKVZMO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1H-indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1H-indole-2-carboxylic acid?
The IUPAC name of ethane;1H-indole-2-carboxylic acid (CID 91052830) is ethane;1H-indole-2-carboxylic acid.
What is the SMILES notation for ethane;1H-indole-2-carboxylic acid?
The canonical SMILES for ethane;1H-indole-2-carboxylic acid is CC.CC.CC.O=C(O)c1cc2ccccc2[nH]1.
What is the InChIKey of ethane;1H-indole-2-carboxylic acid?
The InChIKey is OFSIGLZVOKVZMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2.3C2H6/c11-9(12)8-5-6-3-1-2-4-7(6)10-8;3*1-2/h1-5,10H,(H,11,12);3*1-2H3.
What are the key properties of ethane;1H-indole-2-carboxylic acid?
ethane;1H-indole-2-carboxylic acid has a molecular weight of 251.37 g/mol, XLogP of 4.94, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1H-indole-2-carboxylic acid is sourced from PubChem (CID 91052830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).