About 2-methyl-1H-indole;oxalic acid
2-methyl-1H-indole;oxalic acid (PubChem CID 161360574) has the molecular formula C11H11NO4
and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-methyl-1H-indole;oxalic acid.
Molecular Properties
| Compound Name | 2-methyl-1H-indole;oxalic acid |
| PubChem CID | 161360574 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-methyl-1H-indole;oxalic acid |
| SMILES | Cc1cc2ccccc2[nH]1.O=C(O)C(=O)O |
| InChI | InChI=1S/C9H9N.C2H2O4/c1-7-6-8-4-2-3-5-9(8)10-7;3-1(4)2(5)6/h2-6,10H,1H3;(H,3,4)(H,5,6) |
| InChIKey | VPCPVAXHCWTIHP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1H-indole;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1H-indole;oxalic acid?
The IUPAC name of 2-methyl-1H-indole;oxalic acid (CID 161360574) is 2-methyl-1H-indole;oxalic acid.
What is the SMILES notation for 2-methyl-1H-indole;oxalic acid?
The canonical SMILES for 2-methyl-1H-indole;oxalic acid is Cc1cc2ccccc2[nH]1.O=C(O)C(=O)O.
What is the InChIKey of 2-methyl-1H-indole;oxalic acid?
The InChIKey is VPCPVAXHCWTIHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C2H2O4/c1-7-6-8-4-2-3-5-9(8)10-7;3-1(4)2(5)6/h2-6,10H,1H3;(H,3,4)(H,5,6).
What are the key properties of 2-methyl-1H-indole;oxalic acid?
2-methyl-1H-indole;oxalic acid has a molecular weight of 221.21 g/mol, XLogP of 1.63, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1H-indole;oxalic acid is sourced from PubChem (CID 161360574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).