About 2-methyl-1H-indole;hydrofluoride
2-methyl-1H-indole;hydrofluoride (PubChem CID 163912177) has the molecular formula C9H10FN
and a molecular weight of 151.18 g/mol. Its IUPAC name is 2-methyl-1H-indole;hydrofluoride.
Molecular Properties
| Compound Name | 2-methyl-1H-indole;hydrofluoride |
| PubChem CID | 163912177 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 2-methyl-1H-indole;hydrofluoride |
| SMILES | Cc1cc2ccccc2[nH]1.F |
| InChI | InChI=1S/C9H9N.FH/c1-7-6-8-4-2-3-5-9(8)10-7;/h2-6,10H,1H3;1H |
| InChIKey | FIEMMIJPQZAIIR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methyl-1H-indole;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1H-indole;hydrofluoride?
The IUPAC name of 2-methyl-1H-indole;hydrofluoride (CID 163912177) is 2-methyl-1H-indole;hydrofluoride.
What is the SMILES notation for 2-methyl-1H-indole;hydrofluoride?
The canonical SMILES for 2-methyl-1H-indole;hydrofluoride is Cc1cc2ccccc2[nH]1.F.
What is the InChIKey of 2-methyl-1H-indole;hydrofluoride?
The InChIKey is FIEMMIJPQZAIIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.FH/c1-7-6-8-4-2-3-5-9(8)10-7;/h2-6,10H,1H3;1H.
What are the key properties of 2-methyl-1H-indole;hydrofluoride?
2-methyl-1H-indole;hydrofluoride has a molecular weight of 151.18 g/mol, XLogP of 2.63, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1H-indole;hydrofluoride is sourced from PubChem (CID 163912177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).