About 2,5-dimethyl-1H-indole;ethane;propane
2,5-dimethyl-1H-indole;ethane;propane (PubChem CID 144992538) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is 2,5-dimethyl-1H-indole;ethane;propane.
Molecular Properties
| Compound Name | 2,5-dimethyl-1H-indole;ethane;propane |
| PubChem CID | 144992538 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 2,5-dimethyl-1H-indole;ethane;propane |
| SMILES | CC.CCC.Cc1ccc2[nH]c(C)cc2c1 |
| InChI | InChI=1S/C10H11N.C3H8.C2H6/c1-7-3-4-10-9(5-7)6-8(2)11-10;1-3-2;1-2/h3-6,11H,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | PXJWRXMHVBIDER-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,5-dimethyl-1H-indole;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1H-indole;ethane;propane?
The IUPAC name of 2,5-dimethyl-1H-indole;ethane;propane (CID 144992538) is 2,5-dimethyl-1H-indole;ethane;propane.
What is the SMILES notation for 2,5-dimethyl-1H-indole;ethane;propane?
The canonical SMILES for 2,5-dimethyl-1H-indole;ethane;propane is CC.CCC.Cc1ccc2[nH]c(C)cc2c1.
What is the InChIKey of 2,5-dimethyl-1H-indole;ethane;propane?
The InChIKey is PXJWRXMHVBIDER-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.C3H8.C2H6/c1-7-3-4-10-9(5-7)6-8(2)11-10;1-3-2;1-2/h3-6,11H,1-2H3;3H2,1-2H3;1-2H3.
What are the key properties of 2,5-dimethyl-1H-indole;ethane;propane?
2,5-dimethyl-1H-indole;ethane;propane has a molecular weight of 219.37 g/mol, XLogP of 5.23, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1H-indole;ethane;propane is sourced from PubChem (CID 144992538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).