About 4-methoxy-2-methyl-1H-indole;2-methyl-1H-indole
4-methoxy-2-methyl-1H-indole;2-methyl-1H-indole (PubChem CID 159600634) has the molecular formula C19H20N2O
and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-methoxy-2-methyl-1H-indole;2-methyl-1H-indole.
Molecular Properties
| Compound Name | 4-methoxy-2-methyl-1H-indole;2-methyl-1H-indole |
| PubChem CID | 159600634 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 4-methoxy-2-methyl-1H-indole;2-methyl-1H-indole |
| SMILES | COc1cccc2[nH]c(C)cc12.Cc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C10H11NO.C9H9N/c1-7-6-8-9(11-7)4-3-5-10(8)12-2;1-7-6-8-4-2-3-5-9(8)10-7/h3-6,11H,1-2H3;2-6,10H,1H3 |
| InChIKey | MLKWQOYIQPXACQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methoxy-2-methyl-1H-indole;2-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2-methyl-1H-indole;2-methyl-1H-indole?
The IUPAC name of 4-methoxy-2-methyl-1H-indole;2-methyl-1H-indole (CID 159600634) is 4-methoxy-2-methyl-1H-indole;2-methyl-1H-indole.
What is the SMILES notation for 4-methoxy-2-methyl-1H-indole;2-methyl-1H-indole?
The canonical SMILES for 4-methoxy-2-methyl-1H-indole;2-methyl-1H-indole is COc1cccc2[nH]c(C)cc12.Cc1cc2ccccc2[nH]1.
What is the InChIKey of 4-methoxy-2-methyl-1H-indole;2-methyl-1H-indole?
The InChIKey is MLKWQOYIQPXACQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO.C9H9N/c1-7-6-8-9(11-7)4-3-5-10(8)12-2;1-7-6-8-4-2-3-5-9(8)10-7/h3-6,11H,1-2H3;2-6,10H,1H3.
What are the key properties of 4-methoxy-2-methyl-1H-indole;2-methyl-1H-indole?
4-methoxy-2-methyl-1H-indole;2-methyl-1H-indole has a molecular weight of 292.38 g/mol, XLogP of 4.96, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2-methyl-1H-indole;2-methyl-1H-indole is sourced from PubChem (CID 159600634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).