C20H27N — CID 159710668
methane;2-methyl-1H-indole;1,2,3,5-tetramethylbenzene (PubChem CID 159710668) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is methane;2-methyl-1H-indole;1,2,3,5-tetramethylbenzene.
| Compound Name | methane;2-methyl-1H-indole;1,2,3,5-tetramethylbenzene |
|---|---|
| PubChem CID | 159710668 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | methane;2-methyl-1H-indole;1,2,3,5-tetramethylbenzene |
| SMILES | C.Cc1cc(C)c(C)c(C)c1.Cc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C10H14.C9H9N.CH4/c1-7-5-8(2)10(4)9(3)6-7;1-7-6-8-4-2-3-5-9(8)10-7;/h5-6H,1-4H3;2-6,10H,1H3;1H4 |
| InChIKey | MYUHJAMZUXOFLE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |