About acetylene;(E)-2-ethoxybut-2-ene;2-methyl-1H-indole
acetylene;(E)-2-ethoxybut-2-ene;2-methyl-1H-indole (PubChem CID 143057697) has the molecular formula C17H23NO
and a molecular weight of 257.38 g/mol. Its IUPAC name is acetylene;(E)-2-ethoxybut-2-ene;2-methyl-1H-indole.
Molecular Properties
| Compound Name | acetylene;(E)-2-ethoxybut-2-ene;2-methyl-1H-indole |
| PubChem CID | 143057697 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | acetylene;(E)-2-ethoxybut-2-ene;2-methyl-1H-indole |
| SMILES | C#C.C/C=C(\C)OCC.Cc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C9H9N.C6H12O.C2H2/c1-7-6-8-4-2-3-5-9(8)10-7;1-4-6(3)7-5-2;1-2/h2-6,10H,1H3;4H,5H2,1-3H3;1-2H/b;6-4+; |
| InChIKey | GKYDHHMXSWAZAR-HWWUXOKASA-N |
| XLogP | 4.67 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(E)-2-ethoxybut-2-ene;2-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(E)-2-ethoxybut-2-ene;2-methyl-1H-indole?
The IUPAC name of acetylene;(E)-2-ethoxybut-2-ene;2-methyl-1H-indole (CID 143057697) is acetylene;(E)-2-ethoxybut-2-ene;2-methyl-1H-indole.
What is the SMILES notation for acetylene;(E)-2-ethoxybut-2-ene;2-methyl-1H-indole?
The canonical SMILES for acetylene;(E)-2-ethoxybut-2-ene;2-methyl-1H-indole is C#C.C/C=C(\C)OCC.Cc1cc2ccccc2[nH]1.
What is the InChIKey of acetylene;(E)-2-ethoxybut-2-ene;2-methyl-1H-indole?
The InChIKey is GKYDHHMXSWAZAR-HWWUXOKASA-N. The full InChI is InChI=1S/C9H9N.C6H12O.C2H2/c1-7-6-8-4-2-3-5-9(8)10-7;1-4-6(3)7-5-2;1-2/h2-6,10H,1H3;4H,5H2,1-3H3;1-2H/b;6-4+;.
What are the key properties of acetylene;(E)-2-ethoxybut-2-ene;2-methyl-1H-indole?
acetylene;(E)-2-ethoxybut-2-ene;2-methyl-1H-indole has a molecular weight of 257.38 g/mol, XLogP of 4.67, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(E)-2-ethoxybut-2-ene;2-methyl-1H-indole is sourced from PubChem (CID 143057697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).