C14H16N2 — CID 167244091
(2Z,4Z)-3-(1H-indol-2-yl)hexa-2,4-dien-2-amine (PubChem CID 167244091) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is (2Z,4Z)-3-(1H-indol-2-yl)hexa-2,4-dien-2-amine.
| Compound Name | (2Z,4Z)-3-(1H-indol-2-yl)hexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 167244091 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (2Z,4Z)-3-(1H-indol-2-yl)hexa-2,4-dien-2-amine |
| SMILES | C/C=C\C(=C(/C)N)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H16N2/c1-3-6-12(10(2)15)14-9-11-7-4-5-8-13(11)16-14/h3-9,16H,15H2,1-2H3/b6-3-,12-10- |
| InChIKey | UXPODYJCJGCLCC-KDNURZQZSA-N |
| XLogP | 3.43 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|