About 1H-indole-2-carbothioic S-acid
1H-indole-2-carbothioic S-acid (PubChem CID 4713092) has the molecular formula C9H7NOS
and a molecular weight of 177.23 g/mol. Its IUPAC name is 1H-indole-2-carbothioic S-acid.
Molecular Properties
| Compound Name | 1H-indole-2-carbothioic S-acid |
| PubChem CID | 4713092 |
| Molecular Formula | C9H7NOS |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | 1H-indole-2-carbothioic S-acid |
| SMILES | O=C(S)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C9H7NOS/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h1-5,10H,(H,11,12) |
| InChIKey | HQDQYBAMOPHEBN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole-2-carbothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole-2-carbothioic S-acid?
The IUPAC name of 1H-indole-2-carbothioic S-acid (CID 4713092) is 1H-indole-2-carbothioic S-acid.
What is the SMILES notation for 1H-indole-2-carbothioic S-acid?
The canonical SMILES for 1H-indole-2-carbothioic S-acid is O=C(S)c1cc2ccccc2[nH]1.
What is the InChIKey of 1H-indole-2-carbothioic S-acid?
The InChIKey is HQDQYBAMOPHEBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NOS/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h1-5,10H,(H,11,12).
What are the key properties of 1H-indole-2-carbothioic S-acid?
1H-indole-2-carbothioic S-acid has a molecular weight of 177.23 g/mol, XLogP of 2.24, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole-2-carbothioic S-acid is sourced from PubChem (CID 4713092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).