C26H16N2O6 — CID 70529357
2,5-bis(1H-indole-2-carbonyl)terephthalic acid (PubChem CID 70529357) has the molecular formula C26H16N2O6 and a molecular weight of 452.42 g/mol. Its IUPAC name is 2,5-bis(1H-indole-2-carbonyl)terephthalic acid.
| Compound Name | 2,5-bis(1H-indole-2-carbonyl)terephthalic acid |
|---|---|
| PubChem CID | 70529357 |
| Molecular Formula | C26H16N2O6 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 2,5-bis(1H-indole-2-carbonyl)terephthalic acid |
| SMILES | O=C(O)c1cc(C(=O)c2cc3ccccc3[nH]2)c(C(=O)O)cc1C(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C26H16N2O6/c29-23(21-9-13-5-1-3-7-19(13)27-21)15-11-18(26(33)34)16(12-17(15)25(31)32)24(30)22-10-14-6-2-4-8-20(14)28-22/h1-12,27-28H,(H,31,32)(H,33,34) |
| InChIKey | HCNFJRFADZANPJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 140.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |