C13H10N4O3 — CID 110481756
5-(1H-indole-2-carbonylamino)-1H-pyrazole-4-carboxylic acid (PubChem CID 110481756) has the molecular formula C13H10N4O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is 5-(1H-indole-2-carbonylamino)-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-(1H-indole-2-carbonylamino)-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 110481756 |
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 5-(1H-indole-2-carbonylamino)-1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(Nc1[nH]ncc1C(=O)O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H10N4O3/c18-12(16-11-8(13(19)20)6-14-17-11)10-5-7-3-1-2-4-9(7)15-10/h1-6,15H,(H,19,20)(H2,14,16,17,18) |
| InChIKey | WNVXSEWRBOPORJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 110.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |