C19H16N4O — CID 166403574
N-(4-methyl-5-phenyl-1H-pyrazol-3-yl)-1H-indole-2-carboxamide (PubChem CID 166403574) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is N-(4-methyl-5-phenyl-1H-pyrazol-3-yl)-1H-indole-2-carboxamide.
| Compound Name | N-(4-methyl-5-phenyl-1H-pyrazol-3-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166403574 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-(4-methyl-5-phenyl-1H-pyrazol-3-yl)-1H-indole-2-carboxamide |
| SMILES | Cc1c(NC(=O)c2cc3ccccc3[nH]2)n[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C19H16N4O/c1-12-17(13-7-3-2-4-8-13)22-23-18(12)21-19(24)16-11-14-9-5-6-10-15(14)20-16/h2-11,20H,1H3,(H2,21,22,23,24) |
| InChIKey | NASREMSMLXPUKW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |