About N-(N-bromo-N'-methylcarbamimidoyl)-1H-indole-2-carboxamide
N-(N-bromo-N'-methylcarbamimidoyl)-1H-indole-2-carboxamide (PubChem CID 22097827) has the molecular formula C11H11BrN4O
and a molecular weight of 295.14 g/mol. Its IUPAC name is N-(N-bromo-N'-methylcarbamimidoyl)-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | N-(N-bromo-N'-methylcarbamimidoyl)-1H-indole-2-carboxamide |
| PubChem CID | 22097827 |
| Molecular Formula | C11H11BrN4O |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | N-(N-bromo-N'-methylcarbamimidoyl)-1H-indole-2-carboxamide |
| SMILES | C/N=C(\NBr)NC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H11BrN4O/c1-13-11(16-12)15-10(17)9-6-7-4-2-3-5-8(7)14-9/h2-6,14H,1H3,(H2,13,15,16,17) |
| InChIKey | JSNDPMUGBBJOAK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(N-bromo-N'-methylcarbamimidoyl)-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(N-bromo-N'-methylcarbamimidoyl)-1H-indole-2-carboxamide?
The IUPAC name of N-(N-bromo-N'-methylcarbamimidoyl)-1H-indole-2-carboxamide (CID 22097827) is N-(N-bromo-N'-methylcarbamimidoyl)-1H-indole-2-carboxamide.
What is the SMILES notation for N-(N-bromo-N'-methylcarbamimidoyl)-1H-indole-2-carboxamide?
The canonical SMILES for N-(N-bromo-N'-methylcarbamimidoyl)-1H-indole-2-carboxamide is C/N=C(\NBr)NC(=O)c1cc2ccccc2[nH]1.
What is the InChIKey of N-(N-bromo-N'-methylcarbamimidoyl)-1H-indole-2-carboxamide?
The InChIKey is JSNDPMUGBBJOAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN4O/c1-13-11(16-12)15-10(17)9-6-7-4-2-3-5-8(7)14-9/h2-6,14H,1H3,(H2,13,15,16,17).
What are the key properties of N-(N-bromo-N'-methylcarbamimidoyl)-1H-indole-2-carboxamide?
N-(N-bromo-N'-methylcarbamimidoyl)-1H-indole-2-carboxamide has a molecular weight of 295.14 g/mol, XLogP of 1.78, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(N-bromo-N'-methylcarbamimidoyl)-1H-indole-2-carboxamide is sourced from PubChem (CID 22097827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).