C18H18N4O — CID 70215864
N-[N'-(2-phenylethyl)carbamimidoyl]-1H-indole-2-carboxamide (PubChem CID 70215864) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is N-[N'-(2-phenylethyl)carbamimidoyl]-1H-indole-2-carboxamide.
| Compound Name | N-[N'-(2-phenylethyl)carbamimidoyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70215864 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-[N'-(2-phenylethyl)carbamimidoyl]-1H-indole-2-carboxamide |
| SMILES | N/C(=N\CCc1ccccc1)NC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H18N4O/c19-18(20-11-10-13-6-2-1-3-7-13)22-17(23)16-12-14-8-4-5-9-15(14)21-16/h1-9,12,21H,10-11H2,(H3,19,20,22,23) |
| InChIKey | MKILARJJXLZQNE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|