C18H19ClN4O2 — CID 70214874
N-(N'-methylcarbamimidoyl)-6-phenylmethoxy-1H-indole-2-carboxamide;hydrochloride (PubChem CID 70214874) has the molecular formula C18H19ClN4O2 and a molecular weight of 358.83 g/mol. Its IUPAC name is N-(N'-methylcarbamimidoyl)-6-phenylmethoxy-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-(N'-methylcarbamimidoyl)-6-phenylmethoxy-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70214874 |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-(N'-methylcarbamimidoyl)-6-phenylmethoxy-1H-indole-2-carboxamide;hydrochloride |
| SMILES | C/N=C(\N)NC(=O)c1cc2ccc(OCc3ccccc3)cc2[nH]1.Cl |
| InChI | InChI=1S/C18H18N4O2.ClH/c1-20-18(19)22-17(23)16-9-13-7-8-14(10-15(13)21-16)24-11-12-5-3-2-4-6-12;/h2-10,21H,11H2,1H3,(H3,19,20,22,23);1H |
| InChIKey | AVZLOPURWSIHCI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|