C23H19ClN2O2 — CID 112521847
N-[(4-chlorophenyl)methyl]-6-phenylmethoxy-1H-indole-2-carboxamide (PubChem CID 112521847) has the molecular formula C23H19ClN2O2 and a molecular weight of 390.87 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-6-phenylmethoxy-1H-indole-2-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-6-phenylmethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 112521847 |
| Molecular Formula | C23H19ClN2O2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-6-phenylmethoxy-1H-indole-2-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1cc2ccc(OCc3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/C23H19ClN2O2/c24-19-9-6-16(7-10-19)14-25-23(27)22-12-18-8-11-20(13-21(18)26-22)28-15-17-4-2-1-3-5-17/h1-13,26H,14-15H2,(H,25,27) |
| InChIKey | KGKCNRGCURSUDJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |