C24H22N2O2 — CID 112520813
N-(2,5-dimethylphenyl)-6-phenylmethoxy-1H-indole-2-carboxamide (PubChem CID 112520813) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-6-phenylmethoxy-1H-indole-2-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-6-phenylmethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 112520813 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-(2,5-dimethylphenyl)-6-phenylmethoxy-1H-indole-2-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2cc3ccc(OCc4ccccc4)cc3[nH]2)c1 |
| InChI | InChI=1S/C24H22N2O2/c1-16-8-9-17(2)21(12-16)26-24(27)23-13-19-10-11-20(14-22(19)25-23)28-15-18-6-4-3-5-7-18/h3-14,25H,15H2,1-2H3,(H,26,27) |
| InChIKey | ASFCLQLNRUAPOK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |