C24H23N3O2 — CID 112520492
N-[4-(dimethylamino)phenyl]-6-phenylmethoxy-1H-indole-2-carboxamide (PubChem CID 112520492) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-6-phenylmethoxy-1H-indole-2-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-6-phenylmethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 112520492 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-6-phenylmethoxy-1H-indole-2-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cc3ccc(OCc4ccccc4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C24H23N3O2/c1-27(2)20-11-9-19(10-12-20)25-24(28)23-14-18-8-13-21(15-22(18)26-23)29-16-17-6-4-3-5-7-17/h3-15,26H,16H2,1-2H3,(H,25,28) |
| InChIKey | PASJGGOUKIIYSV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|