C24H21ClN2O2 — CID 112529043
N-[2-(4-chlorophenyl)ethyl]-6-phenylmethoxy-1H-indole-2-carboxamide (PubChem CID 112529043) has the molecular formula C24H21ClN2O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-6-phenylmethoxy-1H-indole-2-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-6-phenylmethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 112529043 |
| Molecular Formula | C24H21ClN2O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-6-phenylmethoxy-1H-indole-2-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1cc2ccc(OCc3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/C24H21ClN2O2/c25-20-9-6-17(7-10-20)12-13-26-24(28)23-14-19-8-11-21(15-22(19)27-23)29-16-18-4-2-1-3-5-18/h1-11,14-15,27H,12-13,16H2,(H,26,28) |
| InChIKey | RBSBEDLCYRCQLM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |