C19H19ClN2O3 — CID 113207545
6-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-1H-indole-2-carboxamide (PubChem CID 113207545) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is 6-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 113207545 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 6-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-1H-indole-2-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2cc3ccc(Cl)cc3[nH]2)cc1OC |
| InChI | InChI=1S/C19H19ClN2O3/c1-24-17-6-3-12(9-18(17)25-2)7-8-21-19(23)16-10-13-4-5-14(20)11-15(13)22-16/h3-6,9-11,22H,7-8H2,1-2H3,(H,21,23) |
| InChIKey | LHDWLFIEMFDPOH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |