C12H11ClN2O3 — CID 75417841
3-[(6-chloro-1H-indole-2-carbonyl)amino]propanoic acid (PubChem CID 75417841) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is 3-[(6-chloro-1H-indole-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[(6-chloro-1H-indole-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 75417841 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-[(6-chloro-1H-indole-2-carbonyl)amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1cc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C12H11ClN2O3/c13-8-2-1-7-5-10(15-9(7)6-8)12(18)14-4-3-11(16)17/h1-2,5-6,15H,3-4H2,(H,14,18)(H,16,17) |
| InChIKey | FHHIVQKMEVHZFF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |