C18H17ClN2O3 — CID 113207547
6-chloro-N-[(3,4-dimethoxyphenyl)methyl]-1H-indole-2-carboxamide (PubChem CID 113207547) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is 6-chloro-N-[(3,4-dimethoxyphenyl)methyl]-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-N-[(3,4-dimethoxyphenyl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 113207547 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 6-chloro-N-[(3,4-dimethoxyphenyl)methyl]-1H-indole-2-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cc3ccc(Cl)cc3[nH]2)cc1OC |
| InChI | InChI=1S/C18H17ClN2O3/c1-23-16-6-3-11(7-17(16)24-2)10-20-18(22)15-8-12-4-5-13(19)9-14(12)21-15/h3-9,21H,10H2,1-2H3,(H,20,22) |
| InChIKey | IGSADPPYBMDVNP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |