C11H11ClN2O — CID 47172452
6-chloro-N-ethyl-1H-indole-2-carboxamide (PubChem CID 47172452) has the molecular formula C11H11ClN2O and a molecular weight of 222.67 g/mol. Its IUPAC name is 6-chloro-N-ethyl-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-N-ethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 47172452 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 6-chloro-N-ethyl-1H-indole-2-carboxamide |
| SMILES | CCNC(=O)c1cc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C11H11ClN2O/c1-2-13-11(15)10-5-7-3-4-8(12)6-9(7)14-10/h3-6,14H,2H2,1H3,(H,13,15) |
| InChIKey | CEJGFKVBCGMVRY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |