C11H10Cl2N2O — CID 167229816
6,7-dichloro-N-ethyl-1H-indole-2-carboxamide (PubChem CID 167229816) has the molecular formula C11H10Cl2N2O and a molecular weight of 257.12 g/mol. Its IUPAC name is 6,7-dichloro-N-ethyl-1H-indole-2-carboxamide.
| Compound Name | 6,7-dichloro-N-ethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167229816 |
| Molecular Formula | C11H10Cl2N2O |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 6,7-dichloro-N-ethyl-1H-indole-2-carboxamide |
| SMILES | CCNC(=O)c1cc2ccc(Cl)c(Cl)c2[nH]1 |
| InChI | InChI=1S/C11H10Cl2N2O/c1-2-14-11(16)8-5-6-3-4-7(12)9(13)10(6)15-8/h3-5,15H,2H2,1H3,(H,14,16) |
| InChIKey | ZPZHAODIBNCLGH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |