C10H9BrClN3O — CID 152714288
7-bromo-4-chloro-N-ethyl-1H-pyrrolo[3,2-c]pyridine-2-carboxamide (PubChem CID 152714288) has the molecular formula C10H9BrClN3O and a molecular weight of 302.56 g/mol. Its IUPAC name is 7-bromo-4-chloro-N-ethyl-1H-pyrrolo[3,2-c]pyridine-2-carboxamide.
| Compound Name | 7-bromo-4-chloro-N-ethyl-1H-pyrrolo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 152714288 |
| Molecular Formula | C10H9BrClN3O |
| Molecular Weight | 302.56 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | 7-bromo-4-chloro-N-ethyl-1H-pyrrolo[3,2-c]pyridine-2-carboxamide |
| SMILES | CCNC(=O)c1cc2c(Cl)ncc(Br)c2[nH]1 |
| InChI | InChI=1S/C10H9BrClN3O/c1-2-13-10(16)7-3-5-8(15-7)6(11)4-14-9(5)12/h3-4,15H,2H2,1H3,(H,13,16) |
| InChIKey | ZUGOXEVQIJRIEQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.56 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|