C16H15Cl2N3O2 — CID 55769960
5,6-dichloro-N-[[3-(ethylcarbamoyl)phenyl]methyl]pyridine-3-carboxamide (PubChem CID 55769960) has the molecular formula C16H15Cl2N3O2 and a molecular weight of 352.22 g/mol. Its IUPAC name is 5,6-dichloro-N-[[3-(ethylcarbamoyl)phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[[3-(ethylcarbamoyl)phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55769960 |
| Molecular Formula | C16H15Cl2N3O2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 5,6-dichloro-N-[[3-(ethylcarbamoyl)phenyl]methyl]pyridine-3-carboxamide |
| SMILES | CCNC(=O)c1cccc(CNC(=O)c2cnc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C16H15Cl2N3O2/c1-2-19-15(22)11-5-3-4-10(6-11)8-21-16(23)12-7-13(17)14(18)20-9-12/h3-7,9H,2,8H2,1H3,(H,19,22)(H,21,23) |
| InChIKey | IASXVKDGPZMMRU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|