C18H19N3O3 — CID 71871569
N-ethyl-3-[[(4-formamidobenzoyl)amino]methyl]benzamide (PubChem CID 71871569) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-ethyl-3-[[(4-formamidobenzoyl)amino]methyl]benzamide.
| Compound Name | N-ethyl-3-[[(4-formamidobenzoyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 71871569 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-ethyl-3-[[(4-formamidobenzoyl)amino]methyl]benzamide |
| SMILES | CCNC(=O)c1cccc(CNC(=O)c2ccc(NC=O)cc2)c1 |
| InChI | InChI=1S/C18H19N3O3/c1-2-19-18(24)15-5-3-4-13(10-15)11-20-17(23)14-6-8-16(9-7-14)21-12-22/h3-10,12H,2,11H2,1H3,(H,19,24)(H,20,23)(H,21,22) |
| InChIKey | NFOSPMRQFKPADI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|