C22H26N4O3 — CID 55804667
N-ethyl-4-[[3-(pyrrolidine-1-carbonyl)phenyl]methylcarbamoylamino]benzamide (PubChem CID 55804667) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-ethyl-4-[[3-(pyrrolidine-1-carbonyl)phenyl]methylcarbamoylamino]benzamide.
| Compound Name | N-ethyl-4-[[3-(pyrrolidine-1-carbonyl)phenyl]methylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 55804667 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-ethyl-4-[[3-(pyrrolidine-1-carbonyl)phenyl]methylcarbamoylamino]benzamide |
| SMILES | CCNC(=O)c1ccc(NC(=O)NCc2cccc(C(=O)N3CCCC3)c2)cc1 |
| InChI | InChI=1S/C22H26N4O3/c1-2-23-20(27)17-8-10-19(11-9-17)25-22(29)24-15-16-6-5-7-18(14-16)21(28)26-12-3-4-13-26/h5-11,14H,2-4,12-13,15H2,1H3,(H,23,27)(H2,24,25,29) |
| InChIKey | BUZNBQJARJGYQZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |