C19H19ClFN3O2 — CID 55747688
1-(4-chloro-3-fluorophenyl)-3-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]urea (PubChem CID 55747688) has the molecular formula C19H19ClFN3O2 and a molecular weight of 375.83 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-3-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]urea.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-3-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55747688 |
| Molecular Formula | C19H19ClFN3O2 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-3-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1cccc(C(=O)N2CCCC2)c1)Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C19H19ClFN3O2/c20-16-7-6-15(11-17(16)21)23-19(26)22-12-13-4-3-5-14(10-13)18(25)24-8-1-2-9-24/h3-7,10-11H,1-2,8-9,12H2,(H2,22,23,26) |
| InChIKey | HJIIAYCGUBMPHY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |