C21H24ClN3O2 — CID 52667072
1-[4-(azepane-1-carbonyl)phenyl]-3-[(2-chlorophenyl)methyl]urea (PubChem CID 52667072) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is 1-[4-(azepane-1-carbonyl)phenyl]-3-[(2-chlorophenyl)methyl]urea.
| Compound Name | 1-[4-(azepane-1-carbonyl)phenyl]-3-[(2-chlorophenyl)methyl]urea |
|---|---|
| PubChem CID | 52667072 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-[4-(azepane-1-carbonyl)phenyl]-3-[(2-chlorophenyl)methyl]urea |
| SMILES | O=C(NCc1ccccc1Cl)Nc1ccc(C(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C21H24ClN3O2/c22-19-8-4-3-7-17(19)15-23-21(27)24-18-11-9-16(10-12-18)20(26)25-13-5-1-2-6-14-25/h3-4,7-12H,1-2,5-6,13-15H2,(H2,23,24,27) |
| InChIKey | RWWGSAUBZOMYRL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |