C20H20N4O2S — CID 55698261
1-(1,3-benzothiazol-2-ylmethyl)-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea (PubChem CID 55698261) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 55698261 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea |
| SMILES | O=C(NCc1nc2ccccc2s1)Nc1ccc(C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H20N4O2S/c25-19(24-11-3-4-12-24)14-7-9-15(10-8-14)22-20(26)21-13-18-23-16-5-1-2-6-17(16)27-18/h1-2,5-10H,3-4,11-13H2,(H2,21,22,26) |
| InChIKey | KBDYSXOZCGPVHW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |