C14H16N4O2S — CID 47018268
1-(1,3-benzothiazol-2-yl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea (PubChem CID 47018268) has the molecular formula C14H16N4O2S and a molecular weight of 304.37 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 47018268 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea |
| SMILES | O=C(NCC(=O)N1CCCC1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H16N4O2S/c19-12(18-7-3-4-8-18)9-15-13(20)17-14-16-10-5-1-2-6-11(10)21-14/h1-2,5-6H,3-4,7-9H2,(H2,15,16,17,20) |
| InChIKey | XYQPVOBXTDVSFM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |