C15H19N3O2S — CID 110912916
1-(1,3-benzothiazol-2-yl)-3-[(1-hydroxycyclohexyl)methyl]urea (PubChem CID 110912916) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-[(1-hydroxycyclohexyl)methyl]urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-[(1-hydroxycyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 110912916 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-[(1-hydroxycyclohexyl)methyl]urea |
| SMILES | O=C(NCC1(O)CCCCC1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H19N3O2S/c19-13(16-10-15(20)8-4-1-5-9-15)18-14-17-11-6-2-3-7-12(11)21-14/h2-3,6-7,20H,1,4-5,8-10H2,(H2,16,17,18,19) |
| InChIKey | JNHJTZINLVPVBL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |