C15H18N2OS — CID 877267
N-(1,3-benzothiazol-2-yl)-1-methylcyclohexane-1-carboxamide (PubChem CID 877267) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-1-methylcyclohexane-1-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-1-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 877267 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-1-methylcyclohexane-1-carboxamide |
| SMILES | CC1(C(=O)Nc2nc3ccccc3s2)CCCCC1 |
| InChI | InChI=1S/C15H18N2OS/c1-15(9-5-2-6-10-15)13(18)17-14-16-11-7-3-4-8-12(11)19-14/h3-4,7-8H,2,5-6,9-10H2,1H3,(H,16,17,18) |
| InChIKey | ILYAJBLLUANDLZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |