C13H15N3O3S2 — CID 129392729
1-(1,3-benzothiazol-2-yl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]urea (PubChem CID 129392729) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]urea |
|---|---|
| PubChem CID | 129392729 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]urea |
| SMILES | C[C@]1(NC(=O)Nc2nc3ccccc3s2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15N3O3S2/c1-13(6-7-21(18,19)8-13)16-11(17)15-12-14-9-4-2-3-5-10(9)20-12/h2-5H,6-8H2,1H3,(H2,14,15,16,17)/t13-/m0/s1 |
| InChIKey | OKLNOWZTZJUXHM-ZDUSSCGKSA-N |
| XLogP | 2.00 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |